C10H16N6O7S — CID 174146579
[2-[N'-[2-(carbamoylamino)acetyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 174146579) has the molecular formula C10H16N6O7S and a molecular weight of 364.34 g/mol. Its IUPAC name is [2-[N'-[2-(carbamoylamino)acetyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[N'-[2-(carbamoylamino)acetyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 174146579 |
| Molecular Formula | C10H16N6O7S |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [2-[N'-[2-(carbamoylamino)acetyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=O)NCC(=O)/N=C(\N)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H16N6O7S/c11-8(14-7(17)3-13-9(12)18)6-2-1-5-4-15(6)10(19)16(5)23-24(20,21)22/h5-6H,1-4H2,(H2,11,14,17)(H3,12,13,18)(H,20,21,22) |
| InChIKey | VVOJETGQLYEMGO-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 197.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|