C13H22N6O6S — CID 172755082
[(2S,5R)-7-oxo-2-[N'-(2-piperazin-2-ylacetyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 172755082) has the molecular formula C13H22N6O6S and a molecular weight of 390.42 g/mol. Its IUPAC name is [(2S,5R)-7-oxo-2-[N'-(2-piperazin-2-ylacetyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-7-oxo-2-[N'-(2-piperazin-2-ylacetyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172755082 |
| Molecular Formula | C13H22N6O6S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [(2S,5R)-7-oxo-2-[N'-(2-piperazin-2-ylacetyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\C(=O)CC1CNCCN1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H22N6O6S/c14-12(17-11(20)5-8-6-15-3-4-16-8)10-2-1-9-7-18(10)13(21)19(9)25-26(22,23)24/h8-10,15-16H,1-7H2,(H2,14,17,20)(H,22,23,24)/t8?,9-,10+/m1/s1 |
| InChIKey | KXGKFALTYGMRGG-XVBQNVSMSA-N |
| XLogP | -2.18 |
| TPSA | 166.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|