C12H16N6O6S — CID 172796452
[(2S,5R)-2-[N'-[2-(1H-imidazol-2-yl)acetyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 172796452) has the molecular formula C12H16N6O6S and a molecular weight of 372.36 g/mol. Its IUPAC name is [(2S,5R)-2-[N'-[2-(1H-imidazol-2-yl)acetyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N'-[2-(1H-imidazol-2-yl)acetyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172796452 |
| Molecular Formula | C12H16N6O6S |
| Molecular Weight | 372.36 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [(2S,5R)-2-[N'-[2-(1H-imidazol-2-yl)acetyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\C(=O)Cc1ncc[nH]1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H16N6O6S/c13-11(16-10(19)5-9-14-3-4-15-9)8-2-1-7-6-17(8)12(20)18(7)24-25(21,22)23/h3-4,7-8H,1-2,5-6H2,(H,14,15)(H2,13,16,19)(H,21,22,23)/t7-,8+/m1/s1 |
| InChIKey | QGNSISSNAJFFNY-SFYZADRCSA-N |
| XLogP | -1.16 |
| TPSA | 171.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.36 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|