C14H18N4O6S — CID 91808132
[(2S)-2-[2-[2-(aminomethyl)-4-pyridinyl]acetyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 91808132) has the molecular formula C14H18N4O6S and a molecular weight of 370.39 g/mol. Its IUPAC name is [(2S)-2-[2-[2-(aminomethyl)-4-pyridinyl]acetyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S)-2-[2-[2-(aminomethyl)-4-pyridinyl]acetyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 91808132 |
| Molecular Formula | C14H18N4O6S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | [(2S)-2-[2-[2-(aminomethyl)-4-pyridinyl]acetyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NCc1cc(CC(=O)[C@@H]2CCC3CN2C(=O)N3OS(=O)(=O)O)ccn1 |
| InChI | InChI=1S/C14H18N4O6S/c15-7-10-5-9(3-4-16-10)6-13(19)12-2-1-11-8-17(12)14(20)18(11)24-25(21,22)23/h3-5,11-12H,1-2,6-8,15H2,(H,21,22,23)/t11?,12-/m0/s1 |
| InChIKey | OIDGFWPCKPEZFA-KIYNQFGBSA-N |
| XLogP | -0.35 |
| TPSA | 143.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|