C14H17N3O7S — CID 66870140
2-pyridin-2-ylethyl (5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 66870140) has the molecular formula C14H17N3O7S and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl (5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | 2-pyridin-2-ylethyl (5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 66870140 |
| Molecular Formula | C14H17N3O7S |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-pyridin-2-ylethyl (5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | O=C(OCCc1ccccn1)C1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H17N3O7S/c18-13(23-8-6-10-3-1-2-7-15-10)12-5-4-11-9-16(12)14(19)17(11)24-25(20,21)22/h1-3,7,11-12H,4-6,8-9H2,(H,20,21,22)/t11-,12?/m1/s1 |
| InChIKey | INNJSASZOFCRTJ-JHJMLUEUSA-N |
| XLogP | 0.17 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|