C12H15N5O7S2 — CID 171441211
[(5R)-7-oxo-2-[(Z)-N'-pyridin-2-ylsulfonylcarbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 171441211) has the molecular formula C12H15N5O7S2 and a molecular weight of 405.41 g/mol. Its IUPAC name is [(5R)-7-oxo-2-[(Z)-N'-pyridin-2-ylsulfonylcarbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(5R)-7-oxo-2-[(Z)-N'-pyridin-2-ylsulfonylcarbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 171441211 |
| Molecular Formula | C12H15N5O7S2 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | [(5R)-7-oxo-2-[(Z)-N'-pyridin-2-ylsulfonylcarbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\S(=O)(=O)c1ccccn1)C1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H15N5O7S2/c13-11(15-25(19,20)10-3-1-2-6-14-10)9-5-4-8-7-16(9)12(18)17(8)24-26(21,22)23/h1-3,6,8-9H,4-5,7H2,(H2,13,15)(H,21,22,23)/t8-,9?/m1/s1 |
| InChIKey | PEKGHZXLXSWQEU-VEDVMXKPSA-N |
| XLogP | -0.87 |
| TPSA | 172.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|