C11H16N6O7S2 — CID 172686474
[(2S,5R)-2-[N'-(1-methylimidazol-4-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 172686474) has the molecular formula C11H16N6O7S2 and a molecular weight of 408.42 g/mol. Its IUPAC name is [(2S,5R)-2-[N'-(1-methylimidazol-4-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N'-(1-methylimidazol-4-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172686474 |
| Molecular Formula | C11H16N6O7S2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [(2S,5R)-2-[N'-(1-methylimidazol-4-yl)sulfonylcarbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | Cn1cnc(S(=O)(=O)N=C(N)[C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H16N6O7S2/c1-15-5-9(13-6-15)25(19,20)14-10(12)8-3-2-7-4-16(8)11(18)17(7)24-26(21,22)23/h5-8H,2-4H2,1H3,(H2,12,14)(H,21,22,23)/t7-,8+/m1/s1 |
| InChIKey | RANXUFNJJJUVJS-SFYZADRCSA-N |
| XLogP | -1.53 |
| TPSA | 177.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|