C12H14N6O6S — CID 174146511
[(2S)-7-oxo-2-[N'-(pyrimidine-5-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 174146511) has the molecular formula C12H14N6O6S and a molecular weight of 370.35 g/mol. Its IUPAC name is [(2S)-7-oxo-2-[N'-(pyrimidine-5-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S)-7-oxo-2-[N'-(pyrimidine-5-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 174146511 |
| Molecular Formula | C12H14N6O6S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | [(2S)-7-oxo-2-[N'-(pyrimidine-5-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\C(=O)c1cncnc1)[C@@H]1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H14N6O6S/c13-10(16-11(19)7-3-14-6-15-4-7)9-2-1-8-5-17(9)12(20)18(8)24-25(21,22)23/h3-4,6,8-9H,1-2,5H2,(H2,13,16,19)(H,21,22,23)/t8?,9-/m0/s1 |
| InChIKey | FCJDUAKJMVHICX-GKAPJAKFSA-N |
| XLogP | -1.02 |
| TPSA | 168.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|