C13H15N5O6S — CID 174146503
[7-oxo-2-[N'-(pyridine-3-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 174146503) has the molecular formula C13H15N5O6S and a molecular weight of 369.36 g/mol. Its IUPAC name is [7-oxo-2-[N'-(pyridine-3-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [7-oxo-2-[N'-(pyridine-3-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 174146503 |
| Molecular Formula | C13H15N5O6S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | [7-oxo-2-[N'-(pyridine-3-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\C(=O)c1cccnc1)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H15N5O6S/c14-11(16-12(19)8-2-1-5-15-6-8)10-4-3-9-7-17(10)13(20)18(9)24-25(21,22)23/h1-2,5-6,9-10H,3-4,7H2,(H2,14,16,19)(H,21,22,23) |
| InChIKey | TWVYNFMMCYHNOR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 155.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|