C10H12N6O7S — CID 172863915
[(2S,5R)-2-[N'-(1,2,5-oxadiazole-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 172863915) has the molecular formula C10H12N6O7S and a molecular weight of 360.31 g/mol. Its IUPAC name is [(2S,5R)-2-[N'-(1,2,5-oxadiazole-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N'-(1,2,5-oxadiazole-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 172863915 |
| Molecular Formula | C10H12N6O7S |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | [(2S,5R)-2-[N'-(1,2,5-oxadiazole-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | N/C(=N\C(=O)c1cnon1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H12N6O7S/c11-8(13-9(17)6-3-12-22-14-6)7-2-1-5-4-15(7)10(18)16(5)23-24(19,20)21/h3,5,7H,1-2,4H2,(H2,11,13,17)(H,19,20,21)/t5-,7+/m1/s1 |
| InChIKey | ZSMUBCVLZPEMGZ-VDTYLAMSSA-N |
| XLogP | -1.43 |
| TPSA | 181.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|