C15H21N4NaO7S — CID 140874764
sodium [(2S,5R)-2-[(2-acetyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 140874764) has the molecular formula C15H21N4NaO7S and a molecular weight of 424.41 g/mol. Its IUPAC name is sodium [(2S,5R)-2-[(2-acetyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-2-[(2-acetyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 140874764 |
| Molecular Formula | C15H21N4NaO7S |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | sodium [(2S,5R)-2-[(2-acetyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | CC(=O)N1CC2(CC(NC(=O)[C@@H]3CC[C@@H]4CN3C(=O)N4OS(=O)(=O)[O-])C2)C1.[Na+] |
| InChI | InChI=1S/C15H22N4O7S.Na/c1-9(20)17-7-15(8-17)4-10(5-15)16-13(21)12-3-2-11-6-18(12)14(22)19(11)26-27(23,24)25;/h10-12H,2-8H2,1H3,(H,16,21)(H,23,24,25);/q;+1/p-1/t11-,12+;/m1./s1 |
| InChIKey | GKNFKKGJELYCTI-LYCTWNKOSA-M |
| XLogP | -4.22 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|