C14H21N4O5S- — CID 134554834
[(2S,5R)-2-[(2-methyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite (PubChem CID 134554834) has the molecular formula C14H21N4O5S- and a molecular weight of 357.41 g/mol. Its IUPAC name is [(2S,5R)-2-[(2-methyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite.
| Compound Name | [(2S,5R)-2-[(2-methyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite |
|---|---|
| PubChem CID | 134554834 |
| Molecular Formula | C14H21N4O5S- |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [(2S,5R)-2-[(2-methyl-2-azaspiro[3.3]heptan-6-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfite |
| SMILES | CN1CC2(CC(NC(=O)[C@@H]3CC[C@@H]4CN3C(=O)N4OS(=O)[O-])C2)C1 |
| InChI | InChI=1S/C14H22N4O5S/c1-16-7-14(8-16)4-9(5-14)15-12(19)11-3-2-10-6-17(11)13(20)18(10)23-24(21)22/h9-11H,2-8H2,1H3,(H,15,19)(H,21,22)/p-1/t10-,11+/m1/s1 |
| InChIKey | IDMXPFUOYDJLQI-MNOVXSKESA-M |
| XLogP | -0.81 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|