C8H12N2O5S — CID 135208822
[(2S,5R)-2-acetyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite (PubChem CID 135208822) has the molecular formula C8H12N2O5S and a molecular weight of 248.26 g/mol. Its IUPAC name is [(2S,5R)-2-acetyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite.
| Compound Name | [(2S,5R)-2-acetyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite |
|---|---|
| PubChem CID | 135208822 |
| Molecular Formula | C8H12N2O5S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | [(2S,5R)-2-acetyl-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfite |
| SMILES | CC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)O |
| InChI | InChI=1S/C8H12N2O5S/c1-5(11)7-3-2-6-4-9(7)8(12)10(6)15-16(13)14/h6-7H,2-4H2,1H3,(H,13,14)/t6-,7+/m1/s1 |
| InChIKey | KUPCQQIGMUEEJB-RQJHMYQMSA-N |
| XLogP | -0.09 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|