C12H16N5NaO7S — CID 172777577
sodium [(2R,5R)-2-[[(2-cyano-2-methylpropanoyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 172777577) has the molecular formula C12H16N5NaO7S and a molecular weight of 397.35 g/mol. Its IUPAC name is sodium [(2R,5R)-2-[[(2-cyano-2-methylpropanoyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2R,5R)-2-[[(2-cyano-2-methylpropanoyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 172777577 |
| Molecular Formula | C12H16N5NaO7S |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | sodium [(2R,5R)-2-[[(2-cyano-2-methylpropanoyl)amino]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | CC(C)(C#N)C(=O)NNC(=O)[C@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C12H17N5O7S.Na/c1-12(2,6-13)10(19)15-14-9(18)8-4-3-7-5-16(8)11(20)17(7)24-25(21,22)23;/h7-8H,3-5H2,1-2H3,(H,14,18)(H,15,19)(H,21,22,23);/q;+1/p-1/t7-,8-;/m1./s1 |
| InChIKey | NUSJTKGZIBQZGQ-SCLLHFNJSA-M |
| XLogP | -4.65 |
| TPSA | 171.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | -4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|