C12H15N6NaO7S — CID 147552108
sodium [(2S,5R)-7-oxo-2-[[2-oxo-3-(triazol-2-yl)propyl]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 147552108) has the molecular formula C12H15N6NaO7S and a molecular weight of 410.34 g/mol. Its IUPAC name is sodium [(2S,5R)-7-oxo-2-[[2-oxo-3-(triazol-2-yl)propyl]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-7-oxo-2-[[2-oxo-3-(triazol-2-yl)propyl]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 147552108 |
| Molecular Formula | C12H15N6NaO7S |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | sodium [(2S,5R)-7-oxo-2-[[2-oxo-3-(triazol-2-yl)propyl]carbamoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | O=C(CNC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-])Cn1nccn1.[Na+] |
| InChI | InChI=1S/C12H16N6O7S.Na/c19-9(7-17-14-3-4-15-17)5-13-11(20)10-2-1-8-6-16(10)12(21)18(8)25-26(22,23)24;/h3-4,8,10H,1-2,5-7H2,(H,13,20)(H,22,23,24);/q;+1/p-1/t8-,10+;/m1./s1 |
| InChIKey | FQYWZHPJIGNACL-SCYNACPDSA-M |
| XLogP | -5.37 |
| TPSA | 166.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | -5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|