C9H12N5NaO5S — CID 155539665
sodium [(2S,5R)-7-oxo-2-(triazol-2-ylmethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 155539665) has the molecular formula C9H12N5NaO5S and a molecular weight of 325.28 g/mol. Its IUPAC name is sodium [(2S,5R)-7-oxo-2-(triazol-2-ylmethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-7-oxo-2-(triazol-2-ylmethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 155539665 |
| Molecular Formula | C9H12N5NaO5S |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | sodium [(2S,5R)-7-oxo-2-(triazol-2-ylmethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | O=C1N2C[C@@H](CC[C@H]2Cn2nccn2)N1OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H13N5O5S.Na/c15-9-12-5-8(14(9)19-20(16,17)18)2-1-7(12)6-13-10-3-4-11-13;/h3-4,7-8H,1-2,5-6H2,(H,16,17,18);/q;+1/p-1/t7-,8+;/m0./s1 |
| InChIKey | GWJBNLKIROPYSY-KZYPOYLOSA-M |
| XLogP | -4.06 |
| TPSA | 120.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|