C8H11F3N2O6S — CID 175964828
[7-oxo-2-(trifluoromethoxymethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 175964828) has the molecular formula C8H11F3N2O6S and a molecular weight of 320.25 g/mol. Its IUPAC name is [7-oxo-2-(trifluoromethoxymethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [7-oxo-2-(trifluoromethoxymethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 175964828 |
| Molecular Formula | C8H11F3N2O6S |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | [7-oxo-2-(trifluoromethoxymethyl)-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | O=C1N2CC(CCC2COC(F)(F)F)N1OS(=O)(=O)O |
| InChI | InChI=1S/C8H11F3N2O6S/c9-8(10,11)18-4-6-2-1-5-3-12(6)7(14)13(5)19-20(15,16)17/h5-6H,1-4H2,(H,15,16,17) |
| InChIKey | WFPYTUNAFSQAEE-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|