C13H20N5NaO6S — CID 172760581
sodium [(2S,5R)-7-oxo-2-[N'-(piperidine-4-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 172760581) has the molecular formula C13H20N5NaO6S and a molecular weight of 397.39 g/mol. Its IUPAC name is sodium [(2S,5R)-7-oxo-2-[N'-(piperidine-4-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-7-oxo-2-[N'-(piperidine-4-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 172760581 |
| Molecular Formula | C13H20N5NaO6S |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | sodium [(2S,5R)-7-oxo-2-[N'-(piperidine-4-carbonyl)carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | N/C(=N\C(=O)C1CCNCC1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H21N5O6S.Na/c14-11(16-12(19)8-3-5-15-6-4-8)10-2-1-9-7-17(10)13(20)18(9)24-25(21,22)23;/h8-10,15H,1-7H2,(H2,14,16,19)(H,21,22,23);/q;+1/p-1/t9-,10+;/m1./s1 |
| InChIKey | LPZKDZXOIXAOJO-UXQCFNEQSA-M |
| XLogP | -4.47 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|