C14H13F3N5NaO6S — CID 166061152
sodium [(2S,5R)-7-oxo-2-[N-[6-(trifluoromethyl)pyridine-3-carbonyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 166061152) has the molecular formula C14H13F3N5NaO6S and a molecular weight of 459.34 g/mol. Its IUPAC name is sodium [(2S,5R)-7-oxo-2-[N-[6-(trifluoromethyl)pyridine-3-carbonyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | sodium [(2S,5R)-7-oxo-2-[N-[6-(trifluoromethyl)pyridine-3-carbonyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 166061152 |
| Molecular Formula | C14H13F3N5NaO6S |
| Molecular Weight | 459.34 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | sodium [(2S,5R)-7-oxo-2-[N-[6-(trifluoromethyl)pyridine-3-carbonyl]carbamimidoyl]-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | [H]/N=C(\NC(=O)c1ccc(C(F)(F)F)nc1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H14F3N5O6S.Na/c15-14(16,17)10-4-1-7(5-19-10)12(23)20-11(18)9-3-2-8-6-21(9)13(24)22(8)28-29(25,26)27;/h1,4-5,8-9H,2-3,6H2,(H2,18,20,23)(H,25,26,27);/q;+1/p-1/t8-,9+;/m1./s1 |
| InChIKey | QTEIZAZNBHFORZ-RJUBDTSPSA-M |
| XLogP | -2.53 |
| TPSA | 155.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.34 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|