C21H20F3N5O3 — CID 166061090
N-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 166061090) has the molecular formula C21H20F3N5O3 and a molecular weight of 447.42 g/mol. Its IUPAC name is N-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166061090 |
| Molecular Formula | C21H20F3N5O3 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carboximidoyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | [H]/N=C(\NC(=O)c1ccc(C(F)(F)F)cn1)[C@@H]1CC[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C21H20F3N5O3/c22-21(23,24)14-6-8-16(26-10-14)19(30)27-18(25)17-9-7-15-11-28(17)20(31)29(15)32-12-13-4-2-1-3-5-13/h1-6,8,10,15,17H,7,9,11-12H2,(H2,25,27,30)/t15-,17+/m1/s1 |
| InChIKey | JSNVOJKSFQWUSM-WBVHZDCISA-N |
| XLogP | 3.21 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|