C14H14F3N5O3 — CID 174146632
N-[amino-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 174146632) has the molecular formula C14H14F3N5O3 and a molecular weight of 357.29 g/mol. Its IUPAC name is N-[amino-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[amino-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174146632 |
| Molecular Formula | C14H14F3N5O3 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[amino-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]methylidene]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | N/C(=N\C(=O)c1ccc(C(F)(F)F)cn1)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C14H14F3N5O3/c15-14(16,17)7-1-3-9(19-5-7)12(23)20-11(18)10-4-2-8-6-21(10)13(24)22(8)25/h1,3,5,8,10,25H,2,4,6H2,(H2,18,20,23)/t8-,10+/m1/s1 |
| InChIKey | CNRUETQRBKOAGD-SCZZXKLOSA-N |
| XLogP | 1.26 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|