C7H7F3N4 — CID 2746581
N'-amino-5-(trifluoromethyl)pyridine-2-carboximidamide (PubChem CID 2746581) has the molecular formula C7H7F3N4 and a molecular weight of 204.16 g/mol. Its IUPAC name is N'-amino-5-(trifluoromethyl)pyridine-2-carboximidamide.
| Compound Name | N'-amino-5-(trifluoromethyl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 2746581 |
| Molecular Formula | C7H7F3N4 |
| Molecular Weight | 204.16 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | N'-amino-5-(trifluoromethyl)pyridine-2-carboximidamide |
| SMILES | NN=C(N)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C7H7F3N4/c8-7(9,10)4-1-2-5(13-3-4)6(11)14-12/h1-3H,12H2,(H2,11,14) |
| InChIKey | XMUIHNJDFNILOA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.16 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|