C14H10F6N4O3S — CID 2746649
N'-[[2-(trifluoromethoxy)phenyl]sulfonylamino]-5-(trifluoromethyl)pyridine-2-carboximidamide (PubChem CID 2746649) has the molecular formula C14H10F6N4O3S and a molecular weight of 428.31 g/mol. Its IUPAC name is N'-[[2-(trifluoromethoxy)phenyl]sulfonylamino]-5-(trifluoromethyl)pyridine-2-carboximidamide.
| Compound Name | N'-[[2-(trifluoromethoxy)phenyl]sulfonylamino]-5-(trifluoromethyl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 2746649 |
| Molecular Formula | C14H10F6N4O3S |
| Molecular Weight | 428.31 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | N'-[[2-(trifluoromethoxy)phenyl]sulfonylamino]-5-(trifluoromethyl)pyridine-2-carboximidamide |
| SMILES | NC(=NNS(=O)(=O)c1ccccc1OC(F)(F)F)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H10F6N4O3S/c15-13(16,17)8-5-6-9(22-7-8)12(21)23-24-28(25,26)11-4-2-1-3-10(11)27-14(18,19)20/h1-7,24H,(H2,21,23) |
| InChIKey | LLIPISSQVCVEHS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|