C13H10F3N3O5S — CID 15160173
5-methoxy-N-[2-(trifluoromethoxy)phenyl]sulfonylpyrimidine-2-carboxamide (PubChem CID 15160173) has the molecular formula C13H10F3N3O5S and a molecular weight of 377.30 g/mol. Its IUPAC name is 5-methoxy-N-[2-(trifluoromethoxy)phenyl]sulfonylpyrimidine-2-carboxamide.
| Compound Name | 5-methoxy-N-[2-(trifluoromethoxy)phenyl]sulfonylpyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 15160173 |
| Molecular Formula | C13H10F3N3O5S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | 5-methoxy-N-[2-(trifluoromethoxy)phenyl]sulfonylpyrimidine-2-carboxamide |
| SMILES | COc1cnc(C(=O)NS(=O)(=O)c2ccccc2OC(F)(F)F)nc1 |
| InChI | InChI=1S/C13H10F3N3O5S/c1-23-8-6-17-11(18-7-8)12(20)19-25(21,22)10-5-3-2-4-9(10)24-13(14,15)16/h2-7H,1H3,(H,19,20) |
| InChIKey | XDGMTLKXSOXXHC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |