C14H12N2O6S — CID 19970342
5-[(2-methoxyphenyl)sulfonylcarbamoyl]pyridine-2-carboxylic acid (PubChem CID 19970342) has the molecular formula C14H12N2O6S and a molecular weight of 336.33 g/mol. Its IUPAC name is 5-[(2-methoxyphenyl)sulfonylcarbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[(2-methoxyphenyl)sulfonylcarbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 19970342 |
| Molecular Formula | C14H12N2O6S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 5-[(2-methoxyphenyl)sulfonylcarbamoyl]pyridine-2-carboxylic acid |
| SMILES | COc1ccccc1S(=O)(=O)NC(=O)c1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C14H12N2O6S/c1-22-11-4-2-3-5-12(11)23(20,21)16-13(17)9-6-7-10(14(18)19)15-8-9/h2-8H,1H3,(H,16,17)(H,18,19) |
| InChIKey | ZDHXOVMWHZRLPG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |