C14H13N3O4S — CID 54564954
5-N-(benzenesulfonyl)-2-N-methylpyridine-2,5-dicarboxamide (PubChem CID 54564954) has the molecular formula C14H13N3O4S and a molecular weight of 319.34 g/mol. Its IUPAC name is 5-N-(benzenesulfonyl)-2-N-methylpyridine-2,5-dicarboxamide.
| Compound Name | 5-N-(benzenesulfonyl)-2-N-methylpyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 54564954 |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 5-N-(benzenesulfonyl)-2-N-methylpyridine-2,5-dicarboxamide |
| SMILES | CNC(=O)c1ccc(C(=O)NS(=O)(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C14H13N3O4S/c1-15-14(19)12-8-7-10(9-16-12)13(18)17-22(20,21)11-5-3-2-4-6-11/h2-9H,1H3,(H,15,19)(H,17,18) |
| InChIKey | ZTDOEUDSDDQUGV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |