C13H8ClF3N2O4S — CID 23002410
6-chloro-N-[2-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide (PubChem CID 23002410) has the molecular formula C13H8ClF3N2O4S and a molecular weight of 380.73 g/mol. Its IUPAC name is 6-chloro-N-[2-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide.
| Compound Name | 6-chloro-N-[2-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 23002410 |
| Molecular Formula | C13H8ClF3N2O4S |
| Molecular Weight | 380.73 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 6-chloro-N-[2-(trifluoromethoxy)phenyl]sulfonylpyridine-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccc1OC(F)(F)F)c1cccc(Cl)n1 |
| InChI | InChI=1S/C13H8ClF3N2O4S/c14-11-7-3-4-8(18-11)12(20)19-24(21,22)10-6-2-1-5-9(10)23-13(15,16)17/h1-7H,(H,19,20) |
| InChIKey | FNABZUHBJBHOGJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.73 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|