C14H23N5O6S — CID 170519375
[(2S,5R)-2-[N-(1-methylpiperidine-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 170519375) has the molecular formula C14H23N5O6S and a molecular weight of 389.43 g/mol. Its IUPAC name is [(2S,5R)-2-[N-(1-methylpiperidine-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N-(1-methylpiperidine-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 170519375 |
| Molecular Formula | C14H23N5O6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [(2S,5R)-2-[N-(1-methylpiperidine-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\NC(=O)C1CCCN(C)C1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C14H23N5O6S/c1-17-6-2-3-9(7-17)13(20)16-12(15)11-5-4-10-8-18(11)14(21)19(10)25-26(22,23)24/h9-11H,2-8H2,1H3,(H2,15,16,20)(H,22,23,24)/t9?,10-,11+/m1/s1 |
| InChIKey | WUGHLVVXQDXBMH-ZOCYIJKUSA-N |
| XLogP | -0.58 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|