C15H25N5O6S — CID 170348699
[(2S,5R)-2-[N-[2-(dimethylamino)cyclopentanecarbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 170348699) has the molecular formula C15H25N5O6S and a molecular weight of 403.46 g/mol. Its IUPAC name is [(2S,5R)-2-[N-[2-(dimethylamino)cyclopentanecarbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N-[2-(dimethylamino)cyclopentanecarbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 170348699 |
| Molecular Formula | C15H25N5O6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [(2S,5R)-2-[N-[2-(dimethylamino)cyclopentanecarbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\NC(=O)C1CCCC1N(C)C)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C15H25N5O6S/c1-18(2)11-5-3-4-10(11)14(21)17-13(16)12-7-6-9-8-19(12)15(22)20(9)26-27(23,24)25/h9-12H,3-8H2,1-2H3,(H2,16,17,21)(H,23,24,25)/t9-,10?,11?,12+/m1/s1 |
| InChIKey | BFAMIPOAGHFVDC-YYJSSNLHSA-N |
| XLogP | -0.19 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|