C16H25N5O7S — CID 170348450
[(2S,5R)-2-[N-(1-acetylazepane-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 170348450) has the molecular formula C16H25N5O7S and a molecular weight of 431.47 g/mol. Its IUPAC name is [(2S,5R)-2-[N-(1-acetylazepane-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N-(1-acetylazepane-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 170348450 |
| Molecular Formula | C16H25N5O7S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [(2S,5R)-2-[N-(1-acetylazepane-3-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\NC(=O)C1CCCCN(C(C)=O)C1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C16H25N5O7S/c1-10(22)19-7-3-2-4-11(8-19)15(23)18-14(17)13-6-5-12-9-20(13)16(24)21(12)28-29(25,26)27/h11-13H,2-9H2,1H3,(H2,17,18,23)(H,25,26,27)/t11?,12-,13+/m1/s1 |
| InChIKey | JBMXCTMTNJRZDC-HDYSRYHKSA-N |
| XLogP | -0.27 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|