C15H23N5O7S — CID 170348747
[(2S,5R)-2-[N-[(3S)-1-acetylpiperidine-3-carbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 170348747) has the molecular formula C15H23N5O7S and a molecular weight of 417.44 g/mol. Its IUPAC name is [(2S,5R)-2-[N-[(3S)-1-acetylpiperidine-3-carbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N-[(3S)-1-acetylpiperidine-3-carbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 170348747 |
| Molecular Formula | C15H23N5O7S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [(2S,5R)-2-[N-[(3S)-1-acetylpiperidine-3-carbonyl]carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\NC(=O)[C@H]1CCCN(C(C)=O)C1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C15H23N5O7S/c1-9(21)18-6-2-3-10(7-18)14(22)17-13(16)12-5-4-11-8-19(12)15(23)20(11)27-28(24,25)26/h10-12H,2-8H2,1H3,(H2,16,17,22)(H,24,25,26)/t10-,11+,12-/m0/s1 |
| InChIKey | MHKXPOYHPLAJPL-TUAOUCFPSA-N |
| XLogP | -0.66 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|