C13H21N5O7S — CID 170348491
[(2S,5R)-2-[N-(1,4-oxazepane-6-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 170348491) has the molecular formula C13H21N5O7S and a molecular weight of 391.41 g/mol. Its IUPAC name is [(2S,5R)-2-[N-(1,4-oxazepane-6-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[N-(1,4-oxazepane-6-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 170348491 |
| Molecular Formula | C13H21N5O7S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | [(2S,5R)-2-[N-(1,4-oxazepane-6-carbonyl)carbamimidoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\NC(=O)C1CNCCOC1)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C13H21N5O7S/c14-11(16-12(19)8-5-15-3-4-24-7-8)10-2-1-9-6-17(10)13(20)18(9)25-26(21,22)23/h8-10,15H,1-7H2,(H2,14,16,19)(H,21,22,23)/t8?,9-,10+/m1/s1 |
| InChIKey | OTIMMPWTJPCRBW-XVBQNVSMSA-N |
| XLogP | -1.68 |
| TPSA | 161.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|