C12H20N4O8S2 — CID 140934817
[2-[amino-(1,1-dioxothian-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 140934817) has the molecular formula C12H20N4O8S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is [2-[amino-(1,1-dioxothian-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[amino-(1,1-dioxothian-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 140934817 |
| Molecular Formula | C12H20N4O8S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | [2-[amino-(1,1-dioxothian-4-yl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NN(C(=O)C1CCC2CN1C(=O)N2OS(=O)(=O)O)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H20N4O8S2/c13-15(8-3-5-25(19,20)6-4-8)11(17)10-2-1-9-7-14(10)12(18)16(9)24-26(21,22)23/h8-10H,1-7,13H2,(H,21,22,23) |
| InChIKey | BTXYGWQBUBHCEH-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 167.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|