C11H17N4NaO7S — CID 141453277
sodium [2-methylpropanoyl-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]azanide (PubChem CID 141453277) has the molecular formula C11H17N4NaO7S and a molecular weight of 372.34 g/mol. Its IUPAC name is sodium [2-methylpropanoyl-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]azanide.
| Compound Name | sodium [2-methylpropanoyl-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]azanide |
|---|---|
| PubChem CID | 141453277 |
| Molecular Formula | C11H17N4NaO7S |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | sodium [2-methylpropanoyl-[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]azanide |
| SMILES | CC(C)C(=O)N([NH-])C(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C11H17N4O7S.Na/c1-6(2)9(16)14(12)10(17)8-4-3-7-5-13(8)11(18)15(7)22-23(19,20)21;/h6-8,12H,3-5H2,1-2H3,(H,19,20,21);/q-1;+1/t7-,8+;/m1./s1 |
| InChIKey | VESADXIASYBLQO-WLYNEOFISA-N |
| XLogP | -3.03 |
| TPSA | 148.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|