C12H21N5O7S — CID 158863830
[(2S,5R)-2-[amino-[3-(dimethylamino)propanoyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 158863830) has the molecular formula C12H21N5O7S and a molecular weight of 379.40 g/mol. Its IUPAC name is [(2S,5R)-2-[amino-[3-(dimethylamino)propanoyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[amino-[3-(dimethylamino)propanoyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 158863830 |
| Molecular Formula | C12H21N5O7S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [(2S,5R)-2-[amino-[3-(dimethylamino)propanoyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CN(C)CCC(=O)N(N)C(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H21N5O7S/c1-14(2)6-5-10(18)16(13)11(19)9-4-3-8-7-15(9)12(20)17(8)24-25(21,22)23/h8-9H,3-7,13H2,1-2H3,(H,21,22,23)/t8-,9+/m1/s1 |
| InChIKey | JAYZYMQCRVNZDV-BDAKNGLRSA-N |
| XLogP | -1.83 |
| TPSA | 153.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|