C12H16N6O7S2 — CID 160606170
[(2S,5R)-2-[amino-[2-(2-amino-1,3-thiazol-4-yl)acetyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 160606170) has the molecular formula C12H16N6O7S2 and a molecular weight of 420.43 g/mol. Its IUPAC name is [(2S,5R)-2-[amino-[2-(2-amino-1,3-thiazol-4-yl)acetyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[amino-[2-(2-amino-1,3-thiazol-4-yl)acetyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 160606170 |
| Molecular Formula | C12H16N6O7S2 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | [(2S,5R)-2-[amino-[2-(2-amino-1,3-thiazol-4-yl)acetyl]carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | Nc1nc(CC(=O)N(N)C(=O)[C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)cs1 |
| InChI | InChI=1S/C12H16N6O7S2/c13-11-15-6(5-26-11)3-9(19)17(14)10(20)8-2-1-7-4-16(8)12(21)18(7)25-27(22,23)24/h5,7-8H,1-4,14H2,(H2,13,15)(H,22,23,24)/t7-,8+/m1/s1 |
| InChIKey | REWXXDFHPGWHNX-SFYZADRCSA-N |
| XLogP | -1.50 |
| TPSA | 189.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|