C12H20N4O7S — CID 90221068
[2-[amino(2-methylbutanoyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90221068) has the molecular formula C12H20N4O7S and a molecular weight of 364.38 g/mol. Its IUPAC name is [2-[amino(2-methylbutanoyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [2-[amino(2-methylbutanoyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90221068 |
| Molecular Formula | C12H20N4O7S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2-[amino(2-methylbutanoyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CCC(C)C(=O)N(N)C(=O)C1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H20N4O7S/c1-3-7(2)10(17)15(13)11(18)9-5-4-8-6-14(9)12(19)16(8)23-24(20,21)22/h7-9H,3-6,13H2,1-2H3,(H,20,21,22) |
| InChIKey | DLGYPZROFZSQGM-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 150.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|