C12H18FN3O7S — CID 58530046
[(3R,4R)-3-fluoropiperidin-4-yl] (2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 58530046) has the molecular formula C12H18FN3O7S and a molecular weight of 367.36 g/mol. Its IUPAC name is [(3R,4R)-3-fluoropiperidin-4-yl] (2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | [(3R,4R)-3-fluoropiperidin-4-yl] (2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 58530046 |
| Molecular Formula | C12H18FN3O7S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [(3R,4R)-3-fluoropiperidin-4-yl] (2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | O=C(O[C@@H]1CCNC[C@H]1F)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C12H18FN3O7S/c13-8-5-14-4-3-10(8)22-11(17)9-2-1-7-6-15(9)12(18)16(7)23-24(19,20)21/h7-10,14H,1-6H2,(H,19,20,21)/t7-,8-,9+,10-/m1/s1 |
| InChIKey | LXEXAEIJAUOEKW-DOLQZWNJSA-N |
| XLogP | -0.77 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|