C18H31N5O9S — CID 144643534
tert-butyl piperidine-1-carboxylate;[(2S)-2-(formamidocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 144643534) has the molecular formula C18H31N5O9S and a molecular weight of 493.54 g/mol. Its IUPAC name is tert-butyl piperidine-1-carboxylate;[(2S)-2-(formamidocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | tert-butyl piperidine-1-carboxylate;[(2S)-2-(formamidocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 144643534 |
| Molecular Formula | C18H31N5O9S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | tert-butyl piperidine-1-carboxylate;[(2S)-2-(formamidocarbamoyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1.O=CNNC(=O)[C@@H]1CCC2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C10H19NO2.C8H12N4O7S/c1-10(2,3)13-9(12)11-7-5-4-6-8-11;13-4-9-10-7(14)6-2-1-5-3-11(6)8(15)12(5)19-20(16,17)18/h4-8H2,1-3H3;4-6H,1-3H2,(H,9,13)(H,10,14)(H,16,17,18)/t;5?,6-/m.0/s1 |
| InChIKey | SWVFVLYQCKXAPX-LVDJIYQJSA-N |
| XLogP | 0.17 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|