C12H18N6O7S — CID 71748170
[(2R,5R)-2-[5-[(1R)-2-(diaminomethylideneamino)-1-hydroxyethyl]-1,2-oxazol-3-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 71748170) has the molecular formula C12H18N6O7S and a molecular weight of 390.38 g/mol. Its IUPAC name is [(2R,5R)-2-[5-[(1R)-2-(diaminomethylideneamino)-1-hydroxyethyl]-1,2-oxazol-3-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5R)-2-[5-[(1R)-2-(diaminomethylideneamino)-1-hydroxyethyl]-1,2-oxazol-3-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 71748170 |
| Molecular Formula | C12H18N6O7S |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [(2R,5R)-2-[5-[(1R)-2-(diaminomethylideneamino)-1-hydroxyethyl]-1,2-oxazol-3-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(N)=NC[C@@H](O)c1cc([C@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)no1 |
| InChI | InChI=1S/C12H18N6O7S/c13-11(14)15-4-9(19)10-3-7(16-24-10)8-2-1-6-5-17(8)12(20)18(6)25-26(21,22)23/h3,6,8-9,19H,1-2,4-5H2,(H4,13,14,15)(H,21,22,23)/t6-,8-,9-/m1/s1 |
| InChIKey | UIZUQQPMUFOQTL-FTLITQJKSA-N |
| XLogP | -1.34 |
| TPSA | 197.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|