C13H19N7O6S — CID 123804080
[(2S,5R)-2-[5-[(3-carbamimidoylazetidin-1-yl)methyl]-1,3,4-oxadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 123804080) has the molecular formula C13H19N7O6S and a molecular weight of 401.41 g/mol. Its IUPAC name is [(2S,5R)-2-[5-[(3-carbamimidoylazetidin-1-yl)methyl]-1,3,4-oxadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[5-[(3-carbamimidoylazetidin-1-yl)methyl]-1,3,4-oxadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123804080 |
| Molecular Formula | C13H19N7O6S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [(2S,5R)-2-[5-[(3-carbamimidoylazetidin-1-yl)methyl]-1,3,4-oxadiazol-2-yl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\N)C1CN(Cc2nnc([C@@H]3CC[C@@H]4CN3C(=O)N4OS(=O)(=O)O)o2)C1 |
| InChI | InChI=1S/C13H19N7O6S/c14-11(15)7-3-18(4-7)6-10-16-17-12(25-10)9-2-1-8-5-19(9)13(21)20(8)26-27(22,23)24/h7-9H,1-6H2,(H3,14,15)(H,22,23,24)/t8-,9+/m1/s1 |
| InChIKey | AUDTYAIHZIUMHJ-BDAKNGLRSA-N |
| XLogP | -0.89 |
| TPSA | 179.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|