C14H22N6O6S — CID 126739230
[(2S,5R)-2-(8-carbamimidoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 126739230) has the molecular formula C14H22N6O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is [(2S,5R)-2-(8-carbamimidoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-(8-carbamimidoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 126739230 |
| Molecular Formula | C14H22N6O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [(2S,5R)-2-(8-carbamimidoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\N)N1CCC2(CC1)CC([C@@H]1CC[C@@H]3CN1C(=O)N3OS(=O)(=O)O)=NO2 |
| InChI | InChI=1S/C14H22N6O6S/c15-12(16)18-5-3-14(4-6-18)7-10(17-25-14)11-2-1-9-8-19(11)13(21)20(9)26-27(22,23)24/h9,11H,1-8H2,(H3,15,16)(H,22,23,24)/t9-,11+/m1/s1 |
| InChIKey | IMQXSZNBANOCCZ-KOLCDFICSA-N |
| XLogP | -0.51 |
| TPSA | 161.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|