C14H24N6O6S — CID 126760525
[(4S)-4-(8-carbamimidoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-3-ethyl-2-oxo-1,3-diazinan-1-yl] hydrogen sulfate (PubChem CID 126760525) has the molecular formula C14H24N6O6S and a molecular weight of 404.45 g/mol. Its IUPAC name is [(4S)-4-(8-carbamimidoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-3-ethyl-2-oxo-1,3-diazinan-1-yl] hydrogen sulfate.
| Compound Name | [(4S)-4-(8-carbamimidoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-3-ethyl-2-oxo-1,3-diazinan-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 126760525 |
| Molecular Formula | C14H24N6O6S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [(4S)-4-(8-carbamimidoyl-1-oxa-2,8-diazaspiro[4.5]dec-2-en-3-yl)-3-ethyl-2-oxo-1,3-diazinan-1-yl] hydrogen sulfate |
| SMILES | [H]/N=C(\N)N1CCC2(CC1)CC([C@@H]1CCN(OS(=O)(=O)O)C(=O)N1CC)=NO2 |
| InChI | InChI=1S/C14H24N6O6S/c1-2-19-11(3-6-20(13(19)21)26-27(22,23)24)10-9-14(25-17-10)4-7-18(8-5-14)12(15)16/h11H,2-9H2,1H3,(H3,15,16)(H,22,23,24)/t11-/m0/s1 |
| InChIKey | LZMLBWORILJABF-NSHDSACASA-N |
| XLogP | -0.26 |
| TPSA | 161.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|