C12H21N5O7S — CID 138718953
[(4S)-3-ethyl-2-oxo-4-[[[(3R)-pyrrolidine-3-carbonyl]amino]carbamoyl]-1,3-diazinan-1-yl] hydrogen sulfate (PubChem CID 138718953) has the molecular formula C12H21N5O7S and a molecular weight of 379.40 g/mol. Its IUPAC name is [(4S)-3-ethyl-2-oxo-4-[[[(3R)-pyrrolidine-3-carbonyl]amino]carbamoyl]-1,3-diazinan-1-yl] hydrogen sulfate.
| Compound Name | [(4S)-3-ethyl-2-oxo-4-[[[(3R)-pyrrolidine-3-carbonyl]amino]carbamoyl]-1,3-diazinan-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 138718953 |
| Molecular Formula | C12H21N5O7S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [(4S)-3-ethyl-2-oxo-4-[[[(3R)-pyrrolidine-3-carbonyl]amino]carbamoyl]-1,3-diazinan-1-yl] hydrogen sulfate |
| SMILES | CCN1C(=O)N(OS(=O)(=O)O)CC[C@H]1C(=O)NNC(=O)[C@@H]1CCNC1 |
| InChI | InChI=1S/C12H21N5O7S/c1-2-16-9(4-6-17(12(16)20)24-25(21,22)23)11(19)15-14-10(18)8-3-5-13-7-8/h8-9,13H,2-7H2,1H3,(H,14,18)(H,15,19)(H,21,22,23)/t8-,9+/m1/s1 |
| InChIKey | MLVNZLBFQKSQIX-BDAKNGLRSA-N |
| XLogP | -2.01 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|