C10H20N4O7S — CID 135243008
[(4S)-4-[[(2S)-2-aminopropoxy]carbamoyl]-3-ethyl-2-oxo-1,3-diazinan-1-yl] hydrogen sulfate (PubChem CID 135243008) has the molecular formula C10H20N4O7S and a molecular weight of 340.36 g/mol. Its IUPAC name is [(4S)-4-[[(2S)-2-aminopropoxy]carbamoyl]-3-ethyl-2-oxo-1,3-diazinan-1-yl] hydrogen sulfate.
| Compound Name | [(4S)-4-[[(2S)-2-aminopropoxy]carbamoyl]-3-ethyl-2-oxo-1,3-diazinan-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 135243008 |
| Molecular Formula | C10H20N4O7S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [(4S)-4-[[(2S)-2-aminopropoxy]carbamoyl]-3-ethyl-2-oxo-1,3-diazinan-1-yl] hydrogen sulfate |
| SMILES | CCN1C(=O)N(OS(=O)(=O)O)CC[C@H]1C(=O)NOC[C@H](C)N |
| InChI | InChI=1S/C10H20N4O7S/c1-3-13-8(9(15)12-20-6-7(2)11)4-5-14(10(13)16)21-22(17,18)19/h7-8H,3-6,11H2,1-2H3,(H,12,15)(H,17,18,19)/t7-,8-/m0/s1 |
| InChIKey | XSPQXDMPWDZJLA-YUMQZZPRSA-N |
| XLogP | -1.37 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|