C14H21N4O7S — CID 156588676
C14H21N4O7S (PubChem CID 156588676) has the molecular formula C14H21N4O7S and a molecular weight of 389.41 g/mol.
| Compound Name | C14H21N4O7S |
|---|---|
| PubChem CID | 156588676 |
| Molecular Formula | C14H21N4O7S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | — |
| SMILES | [O]C1=C2C[C@@H](CC[C@H]2C(=O)NNC(=O)[C@@H]2CCCNC2)N1OS(=O)(=O)O |
| InChI | InChI=1S/C14H21N4O7S/c19-12(8-2-1-5-15-7-8)16-17-13(20)10-4-3-9-6-11(10)14(21)18(9)25-26(22,23)24/h8-10,15H,1-7H2,(H,16,19)(H,17,20)(H,22,23,24)/t8-,9-,10-/m1/s1 |
| InChIKey | MIIYUSYIHFEVIY-OPRDCNLKSA-N |
| XLogP | -1.01 |
| TPSA | 156.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|