C14H25N5O7S — CID 123866850
[formyl-[1-methyl-6-[(piperidine-3-carbonylamino)carbamoyl]piperidin-3-yl]amino] hydrogen sulfate (PubChem CID 123866850) has the molecular formula C14H25N5O7S and a molecular weight of 407.45 g/mol. Its IUPAC name is [formyl-[1-methyl-6-[(piperidine-3-carbonylamino)carbamoyl]piperidin-3-yl]amino] hydrogen sulfate.
| Compound Name | [formyl-[1-methyl-6-[(piperidine-3-carbonylamino)carbamoyl]piperidin-3-yl]amino] hydrogen sulfate |
|---|---|
| PubChem CID | 123866850 |
| Molecular Formula | C14H25N5O7S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [formyl-[1-methyl-6-[(piperidine-3-carbonylamino)carbamoyl]piperidin-3-yl]amino] hydrogen sulfate |
| SMILES | CN1CC(N(C=O)OS(=O)(=O)O)CCC1C(=O)NNC(=O)C1CCCNC1 |
| InChI | InChI=1S/C14H25N5O7S/c1-18-8-11(19(9-20)26-27(23,24)25)4-5-12(18)14(22)17-16-13(21)10-3-2-6-15-7-10/h9-12,15H,2-8H2,1H3,(H,16,21)(H,17,22)(H,23,24,25) |
| InChIKey | DFCUMORBFGJIEU-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|