C8H15N3O2 — CID 123572540
1-carbamimidoyl-4-methylpiperidine-4-carboxylic acid (PubChem CID 123572540) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-carbamimidoyl-4-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-carbamimidoyl-4-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 123572540 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1-carbamimidoyl-4-methylpiperidine-4-carboxylic acid |
| SMILES | [H]/N=C(\N)N1CCC(C)(C(=O)O)CC1 |
| InChI | InChI=1S/C8H15N3O2/c1-8(6(12)13)2-4-11(5-3-8)7(9)10/h2-5H2,1H3,(H3,9,10)(H,12,13) |
| InChIKey | SEDASOPWEPKGKM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|