C11H20N4O4 — CID 83114282
1-[2-(carbamoylamino)ethylcarbamoyl]-4-methylpiperidine-4-carboxylic acid (PubChem CID 83114282) has the molecular formula C11H20N4O4 and a molecular weight of 272.31 g/mol. Its IUPAC name is 1-[2-(carbamoylamino)ethylcarbamoyl]-4-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-[2-(carbamoylamino)ethylcarbamoyl]-4-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 83114282 |
| Molecular Formula | C11H20N4O4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-[2-(carbamoylamino)ethylcarbamoyl]-4-methylpiperidine-4-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)NCCNC(N)=O)CC1 |
| InChI | InChI=1S/C11H20N4O4/c1-11(8(16)17)2-6-15(7-3-11)10(19)14-5-4-13-9(12)18/h2-7H2,1H3,(H,14,19)(H,16,17)(H3,12,13,18) |
| InChIKey | KIVPTYOGLRBCME-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|