C14H22N2O3 — CID 106215938
1-(hex-5-ynylcarbamoyl)-4-methylpiperidine-4-carboxylic acid (PubChem CID 106215938) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(hex-5-ynylcarbamoyl)-4-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-(hex-5-ynylcarbamoyl)-4-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 106215938 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-(hex-5-ynylcarbamoyl)-4-methylpiperidine-4-carboxylic acid |
| SMILES | C#CCCCCNC(=O)N1CCC(C)(C(=O)O)CC1 |
| InChI | InChI=1S/C14H22N2O3/c1-3-4-5-6-9-15-13(19)16-10-7-14(2,8-11-16)12(17)18/h1H,4-11H2,2H3,(H,15,19)(H,17,18) |
| InChIKey | XZOFGNXQFDOZEK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|